1H-Indol-3-ylacetic acid
Catalog No: FT-0679206
CAS No: 6505-45-9
- Chemical Name: 1H-Indol-3-ylacetic acid
- Molecular Formula: C10H8NNaO2
- Molecular Weight: 197.17
- InChI Key: YGSPWCVTJRFZEL-UHFFFAOYSA-M
- InChI: InChI=1S/C10H9NO2.Na/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9;/h1-4,6,11H,5H2,(H,12,13);/q;+1/p-1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Sodium 1H-indol-3-ylacetate |
|---|---|
| Flash_Point: | 171ºC |
| Melting_Point: | 165-169ºC(lit.) |
| FW: | 197.166 |
| Density: | N/A |
| CAS: | 6505-45-9 |
| Bolling_Point: | N/A |
| MF: | C10H8NNaO2 |
| LogP: | 0.46030 |
|---|---|
| Flash_Point: | 171ºC |
| Melting_Point: | 165-169ºC(lit.) |
| FW: | 197.166 |
| PSA: | 55.92000 |
| MF: | C10H8NNaO2 |
| Exact_Mass: | 197.045273 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | 36/37/38 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2915291000 |
| Safety_Statements: | 22-24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)